CAS 1258650-48-4

1,3-Propanediamine, N1,N1-dimethyl-1-phenyl-, hydrobromide (1:2)

Description:

1,3-Propanediamine, N1,N1-dimethyl-1-phenyl-, hydrobromide (1:2) is a chemical compound characterized by its amine functional groups and a hydrobromide salt form. It features a propanediamine backbone with two methyl groups and a phenyl group attached to the nitrogen atom, which contributes to its unique properties. This compound is typically a white to off-white solid and is soluble in water due to the presence of the hydrobromide salt, which enhances its ionic character. The presence of amine groups suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with other substances. It may be used in various applications, including organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Safety data should be consulted for handling, as amines can be irritants and may pose health risks. Overall, its structural features and salt form play a significant role in its chemical behavior and potential applications.

Formula: C₁₁H₁₈N₂·2BrH

InChI: InChI=1S/C11H18N2.2BrH/c1-13(2)11(8-9-12)10-6-4-3-5-7-10;;/h3-7,11H,8-9,12H2,1-2H3;2*1H

InChI key: InChIKey=MQCURSYRCGFTGN-UHFFFAOYSA-N

SMILES: C(CCN)(N(C)C)C1=CC=CC=C1.Br

Synonyms:

• 1,3-Propanediamine, N1,N1-dimethyl-1-phenyl-, hydrobromide (1:2)

(3-Amino-1-phenylpropyl)dimethylamine dihydrobromide

CAS: 1258650-48-4

Versatile small molecule scaffold

Formula: C₁₁H₂₀Br₂N₂

Purity: Min. 95%

Molecular weight: 340.1 g/mol

Ref: 3D-IAC65048