CAS 1258650-49-5

N-[(5-Amino-3-bromo-1-methyl-1H-pyrazol-4-yl)carbonyl]glycine

Description:

N-[(5-Amino-3-bromo-1-methyl-1H-pyrazol-4-yl)carbonyl]glycine, with the CAS number 1258650-49-5, is a chemical compound characterized by its unique structure that includes a pyrazole ring substituted with an amino group and a bromine atom, along with a carbonyl group linked to glycine. This compound is likely to exhibit properties typical of both pyrazole derivatives and amino acids, such as potential biological activity, including antimicrobial or anti-inflammatory effects. The presence of the bromine atom may enhance its reactivity and influence its interaction with biological targets. Additionally, the carbonyl group suggests that it may participate in hydrogen bonding, which can affect its solubility and stability in various solvents. The compound's molecular interactions and potential applications in pharmaceuticals or agrochemicals could be significant, warranting further investigation into its synthesis, reactivity, and biological properties. Overall, this compound represents a class of molecules that may have valuable applications in medicinal chemistry.

Formula: C₇H₉BrN₄O₃

InChI: InChI=1S/C7H9BrN4O3/c1-12-6(9)4(5(8)11-12)7(15)10-2-3(13)14/h2,9H2,1H3,(H,10,15)(H,13,14)

InChI key: InChIKey=UWKQHRBXXNTKHL-UHFFFAOYSA-N

SMILES: C(NCC(O)=O)(=O)C1=C(N)N(C)N=C1Br

Synonyms:

• Glycine, N-[(5-amino-3-bromo-1-methyl-1H-pyrazol-4-yl)carbonyl]-
• N-[(5-Amino-3-bromo-1-methyl-1H-pyrazol-4-yl)carbonyl]glycine

2-[(5-Amino-3-bromo-1-methyl-1H-pyrazol-4-yl)formamido]acetic acid

CAS: 1258650-49-5

Versatile small molecule scaffold

Formula: C₇H₉BrN₄O₃

Purity: Min. 95%

Molecular weight: 277.08 g/mol

Ref: 3D-IAC65049