
CAS 1258650-53-1
:2-Amino-4-methoxy-5-(methylsulfonyl)benzamide
Description:
2-Amino-4-methoxy-5-(methylsulfonyl)benzamide is an organic compound characterized by its aromatic structure, which includes an amino group, a methoxy group, and a methylsulfonyl group attached to a benzene ring. The presence of the amino group (-NH2) indicates that it can participate in hydrogen bonding, potentially enhancing its solubility in polar solvents. The methoxy group (-OCH3) contributes to the compound's electron-donating properties, which can influence its reactivity and interaction with biological targets. The methylsulfonyl group (-SO2CH3) adds to the compound's polarity and may enhance its pharmacological properties, making it of interest in medicinal chemistry. This compound may exhibit various biological activities, and its structural features suggest potential applications in drug development. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-Amino-4-methoxy-5-(methylsulfonyl)benzamide represents a complex molecule with potential utility in various chemical and pharmaceutical contexts.
Formula:C9H12N2O4S
InChI:InChI=1S/C9H12N2O4S/c1-15-7-4-6(10)5(9(11)12)3-8(7)16(2,13)14/h3-4H,10H2,1-2H3,(H2,11,12)
InChI key:InChIKey=VETNONILBYXPEQ-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(OC)C=C(N)C(C(N)=O)=C1
Synonyms:- Benzamide, 2-amino-4-methoxy-5-(methylsulfonyl)-
- 2-Amino-4-methoxy-5-(methylsulfonyl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.