CAS 1258650-62-2

Benzamide, 3-(aminomethyl)-N-(1-methylpropyl)-, hydrochloride (1:1)

Description:

Benzamide, 3-(aminomethyl)-N-(1-methylpropyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from benzoic acid. This substance features a benzene ring substituted with an aminomethyl group and a propyl chain, specifically a 1-methylpropyl group, which contributes to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, enhancing its solubility in water and making it suitable for various applications in pharmaceuticals and biochemistry. The presence of the amino group suggests potential basicity, while the benzamide structure indicates possible interactions with biological targets, such as enzymes or receptors. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for potential hydrogen bonding, influencing its reactivity and interaction with other molecules. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₂H₁₈N₂O·ClH

InChI: InChI=1S/C12H18N2O.ClH/c1-3-9(2)14-12(15)11-6-4-5-10(7-11)8-13;/h4-7,9H,3,8,13H2,1-2H3,(H,14,15);1H

InChI key: InChIKey=YYFZHBQZNSLUHN-UHFFFAOYSA-N

SMILES: C(NC(CC)C)(=O)C1=CC(CN)=CC=C1.Cl

Synonyms:

• 3-(Aminomethyl)-N-(butan-2-yl)benzamide hydrochloride
• Benzamide, 3-(aminomethyl)-N-(1-methylpropyl)-, hydrochloride (1:1)

3-(Aminomethyl)-N-(butan-2-yl)benzamide hydrochloride

CAS: 1258650-62-2

Versatile small molecule scaffold

Formula: C₁₂H₁₉ClN₂O

Purity: Min. 95%

Molecular weight: 242.74 g/mol

Ref: 3D-IAC65062