CymitQuimica logo

CAS 1258650-68-8

:

1,2,3-Benzenetriamine, N1,N3-dicyclopropyl-, hydrochloride (1:3)

Description:
1,2,3-Benzenetriamine, N1,N3-dicyclopropyl-, hydrochloride (1:3) is a chemical compound characterized by its structure, which includes a benzene ring substituted with three amine groups and two cyclopropyl groups attached to the nitrogen atoms. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its stability and reactivity. The presence of multiple amine groups suggests potential for hydrogen bonding and reactivity in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. The cyclopropyl groups contribute to the compound's steric properties and may affect its biological activity. As a hydrochloride, it is likely to be a white crystalline solid, and its properties can be influenced by the pH of the solution. This compound may have applications in organic synthesis, pharmaceuticals, or materials science, although specific uses would depend on further research into its biological and chemical behavior. Safety data and handling precautions should be consulted due to the potential hazards associated with amines.
Formula:C12H17N3·3ClH
InChI:InChI=1S/C12H17N3.3ClH/c13-12-10(14-8-4-5-8)2-1-3-11(12)15-9-6-7-9;;;/h1-3,8-9,14-15H,4-7,13H2;3*1H
InChI key:InChIKey=ZVZHQNOPPLDPNL-UHFFFAOYSA-N
SMILES:N(C1=C(N)C(NC2CC2)=CC=C1)C3CC3.Cl
Synonyms:
  • 1,2,3-Benzenetriamine, N1,N3-dicyclopropyl-, hydrochloride (1:3)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.