CAS 1258650-80-4

α-(4-Chlorophenyl)-2,2-dimethyl-4-morpholineacetonitrile

Description:

α-(4-Chlorophenyl)-2,2-dimethyl-4-morpholineacetonitrile, identified by its CAS number 1258650-80-4, is a chemical compound characterized by its unique structural features. It contains a morpholine ring, which contributes to its potential biological activity, and a nitrile functional group that can influence its reactivity and solubility. The presence of a 4-chlorophenyl group enhances its lipophilicity, potentially affecting its interaction with biological membranes. This compound may exhibit properties typical of nitriles, such as being polar and capable of forming hydrogen bonds, which can impact its solubility in various solvents. Additionally, the dimethyl substitution at the α-position can influence steric hindrance and electronic properties, possibly affecting its reactivity and interactions with other molecules. While specific applications or biological activities may vary, compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.

Formula: C₁₄H₁₇ClN₂O

InChI: InChI=1S/C14H17ClN2O/c1-14(2)10-17(7-8-18-14)13(9-16)11-3-5-12(15)6-4-11/h3-6,13H,7-8,10H2,1-2H3

InChI key: InChIKey=PKFNACDCOLCOPK-UHFFFAOYSA-N

SMILES: C(C#N)(N1CC(C)(C)OCC1)C2=CC=C(Cl)C=C2

Synonyms:

• α-(4-Chlorophenyl)-2,2-dimethyl-4-morpholineacetonitrile
• 4-Morpholineacetonitrile, α-(4-chlorophenyl)-2,2-dimethyl-

2-(4-Chlorophenyl)-2-(2,2-dimethylmorpholin-4-yl)acetonitrile

CAS: 1258650-80-4

Versatile small molecule scaffold

Formula: C₁₄H₁₇ClN₂O

Purity: Min. 95%

Molecular weight: 264.75 g/mol

Ref: 3D-IAC65080