
CAS 1258650-83-7
:3a,4,5,6,7,7a-Hexahydro-1,2-benzisoxazole-3-methanamine
Description:
3a,4,5,6,7,7a-Hexahydro-1,2-benzisoxazole-3-methanamine is a chemical compound characterized by its bicyclic structure, which includes a benzisoxazole moiety fused with a saturated six-membered ring. This compound features a methanamine functional group, contributing to its potential reactivity and biological activity. The presence of nitrogen in the isoxazole ring and the amine group suggests that it may exhibit properties typical of both heterocycles and amines, such as potential basicity and nucleophilicity. The compound's structure implies it may participate in various chemical reactions, including alkylation and acylation. Additionally, its unique configuration may confer specific pharmacological properties, making it of interest in medicinal chemistry. However, detailed studies would be necessary to elucidate its specific applications, toxicity, and interaction with biological systems. As with many organic compounds, the physical properties such as solubility, melting point, and stability can vary significantly based on environmental conditions and the presence of other substances.
Formula:C8H14N2O
InChI:InChI=1S/C8H14N2O/c9-5-7-6-3-1-2-4-8(6)11-10-7/h6,8H,1-5,9H2
InChI key:InChIKey=QZHUHFDCTMNRDQ-UHFFFAOYSA-N
SMILES:C(N)C=1C2C(ON1)CCCC2
Synonyms:- 3a,4,5,6,7,7a-Hexahydro-1,2-benzisoxazole-3-methanamine
- 1,2-Benzisoxazole-3-methanamine, 3a,4,5,6,7,7a-hexahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.