CAS 1258650-85-9

2-[(3-Aminophenyl)(phenylmethyl)amino]acetamide

Description:

2-[(3-Aminophenyl)(phenylmethyl)amino]acetamide, identified by its CAS number 1258650-85-9, is an organic compound characterized by its amide functional group and the presence of both phenyl and amino substituents. This compound features a central acetamide structure, where an amino group is attached to a phenyl ring, which is further substituted by a phenylmethyl group. The presence of the amino group suggests potential basicity and reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. Its structure indicates that it may exhibit properties typical of both amines and amides, such as hydrogen bonding capabilities, which can influence its solubility and interaction with biological systems. The compound may also possess pharmacological properties, making it of interest in medicinal chemistry. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, this compound's unique structure positions it as a potentially valuable entity in chemical research and applications.

Formula: C₁₅H₁₇N₃O

InChI: InChI=1S/C15H17N3O/c16-13-7-4-8-14(9-13)18(11-15(17)19)10-12-5-2-1-3-6-12/h1-9H,10-11,16H2,(H2,17,19)

InChI key: InChIKey=GQFKBZIEFJCYGB-UHFFFAOYSA-N

SMILES: N(CC1=CC=CC=C1)(CC(N)=O)C2=CC(N)=CC=C2

Synonyms:

• Acetamide, 2-[(3-aminophenyl)(phenylmethyl)amino]-
• 2-[(3-Aminophenyl)(phenylmethyl)amino]acetamide

2-[(3-Aminophenyl)(benzyl)amino]acetamide

CAS: 1258650-85-9

Versatile small molecule scaffold

Formula: C₁₅H₁₇N₃O

Purity: Min. 95%

Molecular weight: 255.31 g/mol

Ref: 3D-IAC65085