CAS 1258650-95-1

1-Pyrrolidinepropanamide, N-[4-(aminomethyl)phenyl]-, hydrochloride (1:2)

Description:

1-Pyrrolidinepropanamide, N-[4-(aminomethyl)phenyl]-, hydrochloride (1:2) is a chemical compound characterized by its amide functional group and a pyrrolidine ring, which contributes to its cyclic structure and potential biological activity. The presence of the 4-(aminomethyl)phenyl group indicates that it has an aromatic component, which may enhance its interaction with biological targets. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals. The compound may exhibit properties such as being a potential ligand or inhibitor in biochemical pathways, making it of interest in medicinal chemistry. Its molecular structure suggests it could interact with neurotransmitter systems or other biological mechanisms, although specific biological activities would require empirical investigation. Safety and handling considerations would apply, as with any chemical substance, particularly in terms of toxicity and environmental impact.

Formula: C₁₄H₂₁N₃O·2ClH

InChI: InChI=1S/C14H21N3O.2ClH/c15-11-12-3-5-13(6-4-12)16-14(18)7-10-17-8-1-2-9-17;;/h3-6H,1-2,7-11,15H2,(H,16,18);2*1H

InChI key: InChIKey=COBZGGQATOZPFW-UHFFFAOYSA-N

SMILES: N(C(CCN1CCCC1)=O)C2=CC=C(CN)C=C2.Cl

Synonyms:

• 1-Pyrrolidinepropanamide, N-[4-(aminomethyl)phenyl]-, hydrochloride (1:2)

N-[4-(Aminomethyl)phenyl]-3-(pyrrolidin-1-yl)propanamide dihydrochloride

CAS: 1258650-95-1

Versatile small molecule scaffold

Formula: C₁₄H₂₃Cl₂N₃O

Purity: Min. 95%

Molecular weight: 320.3 g/mol

Ref: 3D-IAC65095