CAS 1258650-99-5

Acetamide, N-[3-(2-aminoethoxy)phenyl]-, hydrochloride (1:1)

Description:

Acetamide, N-[3-(2-aminoethoxy)phenyl]-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from acetic acid. This compound features a phenyl ring substituted with a 2-aminoethoxy group, contributing to its potential biological activity. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical formulations. The presence of the amino group suggests potential interactions with biological systems, possibly influencing its pharmacological properties. This compound may be investigated for its role in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Its molecular structure and functional groups can influence its reactivity, stability, and interaction with other molecules. As with many chemical substances, safety data and handling precautions are essential, especially when dealing with compounds that may have biological effects.

Formula: C₁₀H₁₄N₂O₂·ClH

InChI: InChI=1S/C10H14N2O2.ClH/c1-8(13)12-9-3-2-4-10(7-9)14-6-5-11;/h2-4,7H,5-6,11H2,1H3,(H,12,13);1H

InChI key: InChIKey=DGZQFSZHXZZGMT-UHFFFAOYSA-N

SMILES: N(C(C)=O)C1=CC(OCCN)=CC=C1.Cl

Synonyms:

• Acetamide, N-[3-(2-aminoethoxy)phenyl]-, hydrochloride (1:1)

N-[3-(2-Aminoethoxy)phenyl]acetamide hydrochloride

CAS: 1258650-99-5

Versatile small molecule scaffold

Formula: C₁₀H₁₅ClN₂O₂

Purity: Min. 95%

Molecular weight: 230.69 g/mol

Ref: 3D-IAC65099