CAS 1258651-66-9

4-Piperidinecarboxamide, N-methyl-N-(3-thienylmethyl)-, hydrochloride (1:1)

Description:

4-Piperidinecarboxamide, N-methyl-N-(3-thienylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of the thienylmethyl group indicates that it contains a thiophene moiety, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its pharmacokinetic properties. This compound may exhibit various pharmacological effects, potentially acting as a modulator of neurotransmitter systems, given the structural features that suggest interactions with biological targets. Its molecular structure allows for the possibility of forming hydrogen bonds, influencing its reactivity and interactions with other molecules. The compound's specific applications and effects would depend on ongoing research, particularly in the fields of medicinal chemistry and drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₁₂H₁₈N₂OS·ClH

InChI: InChI=1S/C12H18N2OS.ClH/c1-14(8-10-4-7-16-9-10)12(15)11-2-5-13-6-3-11;/h4,7,9,11,13H,2-3,5-6,8H2,1H3;1H

InChI key: InChIKey=JQBIFDSYRFAPAD-UHFFFAOYSA-N

SMILES: C(N(CC=1C=CSC1)C)(=O)C2CCNCC2.Cl

Synonyms:

• 4-Piperidinecarboxamide, N-methyl-N-(3-thienylmethyl)-, hydrochloride (1:1)

N-Methyl-N-(thiophen-3-ylmethyl)piperidine-4-carboxamide hydrochloride

CAS: 1258651-66-9

Versatile small molecule scaffold

Formula: C₁₂H₁₉ClN₂OS

Purity: Min. 95%

Molecular weight: 274.81 g/mol

Ref: 3D-IAC65166