CAS 1258651-78-3

Benzamide, 4-[(ethylamino)methyl]-N,N-dimethyl-, hydrochloride (1:1)

Description:

Benzamide, 4-[(ethylamino)methyl]-N,N-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from benzoic acid. This substance features a benzene ring substituted with a dimethylamino group and an ethylamino group, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the ethylamino and dimethylamino groups suggests potential biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with biological targets, which may influence its pharmacokinetics and pharmacodynamics. The compound is likely to exhibit moderate to high stability under standard conditions, although specific reactivity can depend on environmental factors such as pH and temperature. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₁₂H₁₈N₂O·ClH

InChI: InChI=1S/C12H18N2O.ClH/c1-4-13-9-10-5-7-11(8-6-10)12(15)14(2)3;/h5-8,13H,4,9H2,1-3H3;1H

InChI key: InChIKey=ZVBSIKPJEDMMTJ-UHFFFAOYSA-N

SMILES: C(N(C)C)(=O)C1=CC=C(CNCC)C=C1.Cl

Synonyms:

• Benzamide, 4-[(ethylamino)methyl]-N,N-dimethyl-, hydrochloride (1:1)

4-[(Ethylamino)methyl]-N,N-dimethylbenzamide hydrochloride

CAS: 1258651-78-3

Versatile small molecule scaffold

Formula: C₁₂H₁₉ClN₂O

Purity: Min. 95%

Molecular weight: 242.74 g/mol

Ref: 3D-IAC65178