
CAS 1258651-82-9
:Methyl 2-amino-4-methoxy-5-(methylthio)benzoate
Description:
Methyl 2-amino-4-methoxy-5-(methylthio)benzoate, identified by its CAS number 1258651-82-9, is an organic compound characterized by its aromatic structure, which includes a methoxy group and a methylthio group attached to a benzoate moiety. This compound features an amino group that contributes to its potential as a building block in pharmaceutical synthesis and organic chemistry. The presence of the methoxy and methylthio substituents can influence its solubility, reactivity, and biological activity, making it of interest in medicinal chemistry. Typically, compounds of this nature may exhibit various properties such as moderate polarity, which can affect their interaction with biological systems. Additionally, the structural features suggest potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. As with many organic compounds, the stability and reactivity can be influenced by environmental factors such as pH and temperature, which are crucial for practical applications in synthesis and formulation.
Formula:C10H13NO3S
InChI:InChI=1S/C10H13NO3S/c1-13-8-5-7(11)6(10(12)14-2)4-9(8)15-3/h4-5H,11H2,1-3H3
InChI key:InChIKey=WTNFCYJPAFQNSB-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(SC)=C(OC)C=C1N
Synonyms:- Benzoic acid, 2-amino-4-methoxy-5-(methylthio)-, methyl ester
- Methyl 2-amino-4-methoxy-5-(methylthio)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.