CAS 1258651-99-8
:3-(Trifluoromethyl)cyclobutanamine
Description:
3-(Trifluoromethyl)cyclobutanamine is a chemical compound characterized by its cyclobutane ring structure, which is a four-membered carbon ring. The presence of a trifluoromethyl group (-CF3) at the 3-position of the cyclobutane enhances its reactivity and influences its physical properties, such as polarity and solubility. The amine functional group (-NH2) contributes to its basicity and potential for hydrogen bonding, making it a candidate for various chemical reactions, including nucleophilic substitutions. This compound may exhibit unique properties due to the electron-withdrawing nature of the trifluoromethyl group, which can affect the acidity of nearby protons and the overall stability of the molecule. Additionally, the trifluoromethyl group can impart lipophilicity, potentially influencing the compound's behavior in biological systems. As with many fluorinated compounds, 3-(Trifluoromethyl)cyclobutanamine may have applications in pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research into its reactivity and interactions.
Formula:C5H8F3N
InChI:InChI=1S/C5H8F3N/c6-5(7,8)3-1-4(9)2-3/h3-4H,1-2,9H2
InChI key:InChIKey=MJHSTECNTRJFSB-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1CC(N)C1
Synonyms:- 3-(Trifluoromethyl)cyclobutanamine
- Cyclobutanamine, 3-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.