CAS 1258652-12-8

2-Methylpyrido[2,3-b]pyrazin-3-amine

Description:

2-Methylpyrido[2,3-b]pyrazin-3-amine is a heterocyclic organic compound characterized by its fused pyridine and pyrazine rings, which contribute to its unique chemical properties. The presence of an amino group at the 3-position of the pyrazine ring enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The methyl group at the 2-position of the pyridine ring influences its electronic properties and steric hindrance, which can affect its interaction with biological targets. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Additionally, the compound's molecular structure suggests potential for hydrogen bonding and π-π stacking interactions, which are relevant in biological systems. Overall, 2-Methylpyrido[2,3-b]pyrazin-3-amine is a compound of interest in both synthetic and pharmaceutical chemistry due to its structural features and potential applications.

Formula: C₈H₈N₄

InChI: InChI=1S/C8H8N4/c1-5-7(9)12-8-6(11-5)3-2-4-10-8/h2-4H,1H3,(H2,9,10,12)

InChI key: InChIKey=UJMINANKXSUKBJ-UHFFFAOYSA-N

SMILES: CC1=NC2=C(N=C1N)N=CC=C2

Synonyms:

• 2-Methylpyrido[2,3-b]pyrazin-3-amine
• Pyrido[2,3-b]pyrazin-3-amine, 2-methyl-