CymitQuimica logo

CAS 1258652-20-8

:

6-Chloro-2-(4-pyridinyl)-1H-indol-3-ol

Description:
6-Chloro-2-(4-pyridinyl)-1H-indol-3-ol is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a chlorine atom at the 6-position and a pyridine group at the 2-position contributes to its unique chemical properties. This compound is typically classified as an indole derivative and may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its hydroxyl group at the 3-position enhances its potential for hydrogen bonding, influencing its solubility and reactivity. The molecular structure suggests that it may interact with various biological targets, potentially serving as a lead compound for drug development. Additionally, the presence of the pyridine moiety may impart specific electronic properties, affecting its overall reactivity and interaction with other molecules. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C13H9ClN2O
InChI:InChI=1S/C13H9ClN2O/c14-9-1-2-10-11(7-9)16-12(13(10)17)8-3-5-15-6-4-8/h1-7,16-17H
InChI key:InChIKey=NALMQIYBTDOVLU-UHFFFAOYSA-N
SMILES:OC1=C(NC=2C1=CC=C(Cl)C2)C=3C=CN=CC3
Synonyms:
  • 1H-Indol-3-ol, 6-chloro-2-(4-pyridinyl)-
  • 6-Chloro-2-(4-pyridinyl)-1H-indol-3-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.