
CAS 1258652-30-0
:1,2,4-Triazolo[4,3-a]pyridine-3-methanamine, N-(1-ethylpropyl)-α-methyl-, hydrochloride (1:1)
Description:
1,2,4-Triazolo[4,3-a]pyridine-3-methanamine, N-(1-ethylpropyl)-α-methyl-, hydrochloride (1:1) is a chemical compound characterized by its complex heterocyclic structure, which includes a triazole ring fused to a pyridine moiety. This compound typically exhibits properties associated with both triazole and pyridine derivatives, such as potential biological activity and solubility in polar solvents. The presence of the methanamine group suggests it may participate in hydrogen bonding, influencing its reactivity and interaction with biological targets. The hydrochloride salt form indicates enhanced stability and solubility in aqueous environments, making it suitable for pharmaceutical applications. Its specific characteristics, including melting point, solubility, and biological activity, would depend on the precise molecular interactions and the presence of substituents. As with many heterocyclic compounds, it may exhibit a range of pharmacological properties, including antimicrobial or anti-inflammatory effects, warranting further investigation for potential therapeutic uses.
Formula:C13H20N4·ClH
InChI:InChI=1S/C13H20N4.ClH/c1-4-11(5-2)14-10(3)13-16-15-12-8-6-7-9-17(12)13;/h6-11,14H,4-5H2,1-3H3;1H
InChI key:InChIKey=JZPGERMPHLHSFE-UHFFFAOYSA-N
SMILES:C(NC(CC)CC)(C)C=1N2C(=NN1)C=CC=C2.Cl
Synonyms:- 1,2,4-Triazolo[4,3-a]pyridine-3-methanamine, N-(1-ethylpropyl)-α-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.