CymitQuimica logo

CAS 1258652-51-5

:

3-Pyridinecarbonitrile, 2-[(3-pyrrolidinylmethyl)amino]-, hydrochloride (1:1)

Description:
3-Pyridinecarbonitrile, 2-[(3-pyrrolidinylmethyl)amino]-, hydrochloride (1:1) is a chemical compound characterized by its pyridine and pyrrolidine functional groups, which contribute to its biological activity and potential pharmacological properties. The presence of the pyridine ring suggests that it may exhibit basic properties, while the nitrile group can influence its reactivity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. This compound may be of interest in medicinal chemistry due to its structural features that could interact with biological targets, potentially leading to therapeutic effects. Its molecular structure indicates the presence of both amine and nitrile functionalities, which can participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. Overall, this compound's unique combination of functional groups positions it as a candidate for further research in drug development and synthesis.
Formula:C11H14N4·ClH
InChI:InChI=1S/C11H14N4.ClH/c12-6-10-2-1-4-14-11(10)15-8-9-3-5-13-7-9;/h1-2,4,9,13H,3,5,7-8H2,(H,14,15);1H
InChI key:InChIKey=YPONUCKCYADQCG-UHFFFAOYSA-N
SMILES:N(CC1CCNC1)C2=C(C#N)C=CC=N2.Cl
Synonyms:
  • 3-Pyridinecarbonitrile, 2-[(3-pyrrolidinylmethyl)amino]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.