CAS 1258652-60-6: 1-(1,1-Dimethylethyl) 4-(4-phenyl-1H-1,2,3-triazol-1-yl)-1,2-pyrrolidinedicarboxylate
Description:1-(1,1-Dimethylethyl) 4-(4-phenyl-1H-1,2,3-triazol-1-yl)-1,2-pyrrolidinedicarboxylate, with the CAS number 1258652-60-6, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and a triazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential stability under standard laboratory conditions. The presence of the triazole group suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, the tert-butyl group may enhance lipophilicity, influencing the compound's bioavailability and pharmacokinetics. Its unique structure may also confer specific reactivity patterns, making it of interest in synthetic organic chemistry. Overall, this compound represents a class of derivatives that could be explored for various applications, including agrochemicals and materials science, depending on its functional properties and interactions.
Formula:C18H22N4O4
InChI:InChI=1S/C18H22N4O4/c1-18(2,3)26-17(25)21-10-13(9-15(21)16(23)24)22-11-14(19-20-22)12-7-5-4-6-8-12/h4-8,11,13,15H,9-10H2,1-3H3,(H,23,24)
InChI key:InChIKey=ADNVHPPFKNQHHE-UHFFFAOYSA-N
SMILES:O=C(O)C1N(C(=O)OC(C)(C)C)CC(N2N=NC(=C2)C=3C=CC=CC3)C1
- Synonyms:
- 1,2-Pyrrolidinedicarboxylic acid, 4-(4-phenyl-1H-1,2,3-triazol-1-yl)-, 1-(1,1-dimethylethyl) ester
- 1-(1,1-Dimethylethyl) 4-(4-phenyl-1H-1,2,3-triazol-1-yl)-1,2-pyrrolidinedicarboxylate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-(tert-Butoxycarbonyl)-4-(4-phenyl-1H-1,2,3-triazol-1-yl)pyrrolidine-2-carboxylic acid REF: 54-OR323088CAS: 1258652-60-6 | - - - | To inquire | Tue 22 Apr 25 |
![]() | 1-(Tert-butoxycarbonyl)-4-(4-phenyl-1H-1,2,3-triazol-1-yl)pyrrolidine-2-carboxylic acid REF: 10-F734361CAS: 1258652-60-6 | 95+% | - - - | Discontinued product |
![]() | 1-(tert-Butoxycarbonyl)-4-(4-phenyl-1H-1,2,3-triazol-1-yl)pyrrolidine-2-carboxylic acid REF: 3D-IAC65260CAS: 1258652-60-6 | Min. 95% | - - - | Discontinued product |

1-(tert-Butoxycarbonyl)-4-(4-phenyl-1H-1,2,3-triazol-1-yl)pyrrolidine-2-carboxylic acid
Ref: 54-OR323088
Undefined size | To inquire |

1-(Tert-butoxycarbonyl)-4-(4-phenyl-1H-1,2,3-triazol-1-yl)pyrrolidine-2-carboxylic acid
Ref: 10-F734361
1g | Discontinued | Request information | |
250mg | Discontinued | Request information |

1-(tert-Butoxycarbonyl)-4-(4-phenyl-1H-1,2,3-triazol-1-yl)pyrrolidine-2-carboxylic acid
Ref: 3D-IAC65260
1g | Discontinued | Request information | |
500mg | Discontinued | Request information |