CAS 1258652-72-0
:Ethyl 2-[[[5-chloro-1,6-dihydro-2-methyl-1-(1-methylethyl)-6-oxo-4-pyrimidinyl]oxy]methyl]benzenepropanoate
Description:
Ethyl 2-[[[5-chloro-1,6-dihydro-2-methyl-1-(1-methylethyl)-6-oxo-4-pyrimidinyl]oxy]methyl]benzenepropanoate is a complex organic compound characterized by its unique structural features, including a pyrimidine ring and an ester functional group. The presence of a chloro substituent and a dihydro-pyrimidine structure suggests potential biological activity, possibly as a pharmaceutical agent. The compound's molecular structure indicates it may exhibit lipophilic properties due to the ethyl and isopropyl groups, which can influence its solubility and permeability in biological systems. Additionally, the benzene ring contributes to its aromatic characteristics, potentially affecting its reactivity and interaction with other molecules. The compound's synthesis and applications may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies and literature review.
Formula:C20H25ClN2O4
InChI:InChI=1S/C20H25ClN2O4/c1-5-26-17(24)11-10-15-8-6-7-9-16(15)12-27-19-18(21)20(25)23(13(2)3)14(4)22-19/h6-9,13H,5,10-12H2,1-4H3
InChI key:InChIKey=VJGHUWTWDDWTBA-UHFFFAOYSA-N
SMILES:O(CC1=C(CCC(OCC)=O)C=CC=C1)C2=C(Cl)C(=O)N(C(C)C)C(C)=N2
Synonyms:- Ethyl 2-[[[5-chloro-1,6-dihydro-2-methyl-1-(1-methylethyl)-6-oxo-4-pyrimidinyl]oxy]methyl]benzenepropanoate
- Benzenepropanoic acid, 2-[[[5-chloro-1,6-dihydro-2-methyl-1-(1-methylethyl)-6-oxo-4-pyrimidinyl]oxy]methyl]-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 3-(2-((5-chloro-1,6-dihydro-1-isopropyl-2-mEthyl-6-oxopyrimidin-4-yloxy)mEthyl)phenyl)propanoa
CAS:Ethyl 3-(2-((5-chloro-1,6-dihydro-1-isopropyl-2-mEthyl-6-oxopyrimidin-4-yloxy)mEthyl)phenyl)propanoa
Molecular weight:392.88g/mol
