CAS 125867-26-7
:N-[3-(Hydroxyphenylmethyl)-4-pyridinyl]-2,2-dimethylpropanamide
Description:
N-[3-(Hydroxyphenylmethyl)-4-pyridinyl]-2,2-dimethylpropanamide, with the CAS number 125867-26-7, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a hydroxyphenylmethyl group. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential hydrogen bonding due to the presence of the hydroxyl group. The pyridine moiety may contribute to its biological activity, potentially influencing its interaction with various biological targets. The presence of the dimethylpropanamide group suggests steric hindrance, which could affect its reactivity and binding affinity in biochemical contexts. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that could impart specific pharmacological properties. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental factors such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C17H20N2O2
InChI:InChI=1S/C17H20N2O2/c1-17(2,3)16(21)19-14-9-10-18-11-13(14)15(20)12-7-5-4-6-8-12/h4-11,15,20H,1-3H3,(H,18,19,21)
InChI key:InChIKey=WYRQALJIHGGMSO-UHFFFAOYSA-N
SMILES:C(O)(C=1C(NC(C(C)(C)C)=O)=CC=NC1)C2=CC=CC=C2
Synonyms:- Propanamide, N-[3-(hydroxyphenylmethyl)-4-pyridinyl]-2,2-dimethyl-
- N-[3-(Hydroxyphenylmethyl)-4-pyridinyl]-2,2-dimethylpropanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
