CymitQuimica logo

CAS 125867-32-5

:

N-(3-benzoylpyridin-2-yl)-2,2-dimethylpropanamide

Description:
N-(3-benzoylpyridin-2-yl)-2,2-dimethylpropanamide, identified by its CAS number 125867-32-5, is a chemical compound that features a complex structure combining a pyridine ring and a benzoyl group. This compound typically exhibits characteristics common to amides, such as moderate solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the amide functional group. The benzoyl and pyridine moieties contribute to its potential as a ligand in coordination chemistry and its utility in various organic synthesis applications. Additionally, the presence of the dimethylpropanamide structure may influence its steric properties and reactivity. The compound's specific physical properties, such as melting point, boiling point, and spectral characteristics, would depend on its molecular interactions and purity. Overall, N-(3-benzoylpyridin-2-yl)-2,2-dimethylpropanamide is of interest in medicinal chemistry and material science due to its unique structural features and potential biological activity.
Formula:C17H18N2O2
InChI:InChI=1/C17H18N2O2/c1-17(2,3)16(21)19-15-13(10-7-11-18-15)14(20)12-8-5-4-6-9-12/h4-11H,1-3H3,(H,18,19,21)
SMILES:CC(C)(C)C(=O)Nc1c(cccn1)C(=O)c1ccccc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.