CymitQuimica logo

CAS 125872-96-0

:

5-(Bromomethyl)-2-methylbenzothiazole

Description:
5-(Bromomethyl)-2-methylbenzothiazole is an organic compound characterized by its unique structure, which includes a benzothiazole moiety and a bromomethyl group. This compound features a fused benzene and thiazole ring, contributing to its aromatic properties and potential reactivity. The presence of the bromomethyl group enhances its electrophilic character, making it a useful intermediate in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The compound's reactivity can be attributed to the bromine atom, which can participate in nucleophilic substitution reactions. Additionally, the methyl group on the benzothiazole ring can influence the compound's electronic properties and steric hindrance. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 5-(Bromomethyl)-2-methylbenzothiazole serves as a valuable building block in organic synthesis and materials science.
Formula:C9H8BrNS
InChI:InChI=1S/C9H8BrNS/c1-6-11-8-4-7(5-10)2-3-9(8)12-6/h2-4H,5H2,1H3
InChI key:InChIKey=KRFQAVUFGKIXSK-UHFFFAOYSA-N
SMILES:CC=1SC=2C(=CC(CBr)=CC2)N1
Synonyms:
  • 5-(Bromomethyl)-2-methyl-1,3-benzothiazole
  • Benzothiazole, 5-(bromomethyl)-2-methyl-
  • 5-(Bromomethyl)-2-methylbenzothiazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.