
CAS 1258826-71-9
:3-Methyl-1-[2-oxo-2-(1-piperazinyl)ethyl]-1H-pyrrole-2,5-dione
Description:
3-Methyl-1-[2-oxo-2-(1-piperazinyl)ethyl]-1H-pyrrole-2,5-dione, with the CAS number 1258826-71-9, is a synthetic organic compound characterized by its unique pyrrole structure, which features a 1H-pyrrole ring substituted with a methyl group and a piperazinyl moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the piperazine ring, which is known for its role in pharmacology. The presence of the 2-oxo group contributes to its reactivity and may influence its interactions with biological targets. The compound is likely to be soluble in polar solvents, given the functional groups present, and may exhibit moderate stability under standard conditions. Its specific applications and biological activities would depend on further empirical studies, but compounds of this nature are often explored for their potential in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases.
Formula:C11H15N3O3
InChI:InChI=1S/C11H15N3O3/c1-8-6-9(15)14(11(8)17)7-10(16)13-4-2-12-3-5-13/h6,12H,2-5,7H2,1H3
InChI key:InChIKey=JXNVYYDZPYTAOJ-UHFFFAOYSA-N
SMILES:C(C(=O)N1CCNCC1)N2C(=O)C(C)=CC2=O
Synonyms:- 3-Methyl-1-[2-oxo-2-(1-piperazinyl)ethyl]-1H-pyrrole-2,5-dione
- 1H-Pyrrole-2,5-dione, 3-methyl-1-[2-oxo-2-(1-piperazinyl)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.