
CAS 1258826-83-3
:3-[(5-Methyl-1,2,4-oxadiazol-3-yl)methyl]piperidine
Description:
3-[(5-Methyl-1,2,4-oxadiazol-3-yl)methyl]piperidine is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The presence of a 5-methyl-1,2,4-oxadiazol-3-yl group indicates that the compound features a five-membered heterocyclic structure containing two nitrogen atoms and an oxygen atom, contributing to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the presence of both the piperidine and oxadiazole moieties, which can influence its solubility in various solvents. The oxadiazole ring may impart biological activity, making it of interest in medicinal chemistry. Additionally, the methyl group on the oxadiazole can affect the compound's reactivity and stability. Overall, this compound's structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C9H15N3O
InChI:InChI=1S/C9H15N3O/c1-7-11-9(12-13-7)5-8-3-2-4-10-6-8/h8,10H,2-6H2,1H3
InChI key:InChIKey=UIVPKOOMHSYUNJ-UHFFFAOYSA-N
SMILES:C(C1=NOC(C)=N1)C2CCCNC2
Synonyms:- 3-[(5-Methyl-1,2,4-oxadiazol-3-yl)methyl]piperidine
- Piperidine, 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-
- 5-Methyl-3-(piperidin-3-ylmethyl)-1,2,4-oxadiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.