CAS 1258960-01-8

7-Methoxy-4-benzofurancarbonitrile

Description:

7-Methoxy-4-benzofurancarbonitrile is a chemical compound characterized by its unique structure, which includes a benzofuran moiety and a cyano group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the nitrile functional group. The methoxy group contributes to its solubility in organic solvents and may influence its reactivity and interaction with biological systems. As a nitrile, it may participate in nucleophilic addition reactions and can serve as a precursor for various synthetic pathways. The compound's specific applications may vary, but it is often explored in medicinal chemistry and material science due to its potential biological activity and utility in organic synthesis. Its molecular structure suggests that it may exhibit interesting electronic properties, making it a candidate for further research in fields such as drug development or as a building block in organic synthesis. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₁₀H₇NO₂

InChI: InChI=1S/C10H7NO2/c1-12-9-3-2-7(6-11)8-4-5-13-10(8)9/h2-5H,1H3

InChI key: InChIKey=SHRGWKRJXIQHND-UHFFFAOYSA-N

SMILES: C(#N)C1=C2C(=C(OC)C=C1)OC=C2

Synonyms:

• 4-Benzofurancarbonitrile, 7-methoxy-
• 7-Methoxy-4-benzofurancarbonitrile