CAS 1258963-55-1

(3R,4R)-4-(4-Bromophenoxy)tetrahydro-3-furanamine

Description:

(3R,4R)-4-(4-Bromophenoxy)tetrahydro-3-furanamine is a chemical compound characterized by its specific stereochemistry, indicated by the (3R,4R) configuration, which suggests that it has two chiral centers. This compound features a tetrahydrofuran ring, which is a five-membered cyclic ether, contributing to its structural rigidity and potential for specific interactions with biological targets. The presence of a bromophenoxy group enhances its lipophilicity and may influence its reactivity and binding properties. The amine functional group indicates that it can participate in hydrogen bonding, which is significant for its solubility and interaction with other molecules. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its unique structure allows for potential applications in various fields, including drug design and synthesis. As with many organic compounds, its stability, reactivity, and biological activity can be influenced by environmental factors such as pH and temperature.

Formula: C₁₀H₁₂BrNO₂

InChI: InChI=1S/C10H12BrNO2/c11-7-1-3-8(4-2-7)14-10-6-13-5-9(10)12/h1-4,9-10H,5-6,12H2/t9-,10+/m1/s1

InChI key: InChIKey=GRTOEAAOPRPWSN-ZJUUUORDSA-N

SMILES: O([C@@H]1[C@H](N)COC1)C2=CC=C(Br)C=C2

Synonyms:

• (3R,4R)-4-(4-Bromophenoxy)tetrahydro-3-furanamine
• 3-Furanamine, 4-(4-bromophenoxy)tetrahydro-, (3R,4R)-
• (3R,4R)-4-(4-Bromophenoxy)tetrahydrofuran-3-amine