CAS 125902-27-4
:1,8-Naphthyridine-2-methanol
Description:
1,8-Naphthyridine-2-methanol is an organic compound characterized by its naphthyridine structure, which consists of a bicyclic aromatic system containing nitrogen atoms. This compound features a hydroxymethyl group (-CH2OH) at the 2-position of the naphthyridine ring, contributing to its reactivity and potential applications in medicinal chemistry. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydroxymethyl group. The compound's nitrogen atoms can participate in hydrogen bonding, influencing its physical properties and interactions with biological targets. 1,8-Naphthyridine derivatives are often studied for their pharmacological activities, including antimicrobial and anticancer properties. The specific characteristics, such as melting point, boiling point, and spectral data, can vary based on the purity and form of the compound. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C9H8N2O
InChI:InChI=1S/C9H8N2O/c12-6-8-4-3-7-2-1-5-10-9(7)11-8/h1-5,12H,6H2
InChI key:InChIKey=HAYNENROUNWMBN-UHFFFAOYSA-N
SMILES:C(O)C1=NC2=C(C=C1)C=CC=N2
Synonyms:- 1,8-Naphthyridine-2-methanol
- [1,8]Naphthyridin-2-ylmethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
