CAS 125907-93-9

1,3-Propanediol, 2,2′,2′′-nitrilotris[2-(hydroxymethyl)-

Description:

1,3-Propanediol, 2,2′,2′′-nitrilotris[2-(hydroxymethyl)-, commonly referred to by its CAS number 125907-93-9, is a chemical compound characterized by its structure that includes a propanediol backbone and multiple hydroxymethyl groups. This compound features a nitrilotris moiety, which contributes to its potential as a multifunctional agent in various applications. It is typically a colorless to pale yellow liquid, exhibiting good solubility in water due to the presence of hydroxyl groups. The presence of multiple hydroxymethyl groups enhances its reactivity and makes it suitable for use in the synthesis of polymers, surfactants, and other chemical intermediates. Additionally, it may possess properties that allow it to act as a chelating agent or a stabilizer in formulations. Its safety profile and environmental impact would need to be assessed for specific applications, as with any chemical substance. Overall, this compound is of interest in both industrial and research settings for its versatile chemical properties.

Formula: C₁₂H₂₇NO₉

InChI: InChI=1S/C12H27NO9/c14-1-10(2-15,3-16)13(11(4-17,5-18)6-19)12(7-20,8-21)9-22/h14-22H,1-9H2

InChI key: InChIKey=BQUWTHKUYAKIQX-UHFFFAOYSA-N

SMILES: N(C(CO)(CO)CO)(C(CO)(CO)CO)C(CO)(CO)CO

Synonyms:

• 1,3-Propanediol, 2,2′,2′′-nitrilotris[2-(hydroxymethyl)-

1,3-Propanediol, 2,2',2''-nitrilotris[2-(hydroxymethyl)- (9CI)

CAS: 125907-93-9

Formula: C₁₂H₂₇NO₉

Molecular weight: 329.3441

Ref: IN-DA000OYO