CAS 1259224-12-8
:3-Chloro-6-methylisoquinoline
Description:
3-Chloro-6-methylisoquinoline is a heterocyclic organic compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the 3-position and a methyl group at the 6-position contributes to its unique chemical properties. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents. It may possess biological activity, making it of interest in medicinal chemistry and drug development. The chlorine substituent can influence the compound's reactivity and interaction with biological targets, while the methyl group can affect its lipophilicity and overall stability. As with many isoquinoline derivatives, 3-chloro-6-methylisoquinoline may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C10H8ClN
InChI:InChI=1S/C10H8ClN/c1-7-2-3-8-6-12-10(11)5-9(8)4-7/h2-6H,1H3
InChI key:InChIKey=IIKLBKPDZFJVKF-UHFFFAOYSA-N
SMILES:ClC1=CC2=C(C=CC(C)=C2)C=N1
Synonyms:- Isoquinoline, 3-chloro-6-methyl-
- 3-Chloro-6-methylisoquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
