CymitQuimica logo

CAS 125923-10-6

:

1H-Pyrrole-2,5-dione, 1-(2-aminoethyl)-

Description:
1H-Pyrrole-2,5-dione, 1-(2-aminoethyl)-, also known by its CAS number 125923-10-6, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing nitrogen. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups, and an aminoethyl side chain, which contributes to its reactivity and potential biological activity. The presence of the amino group suggests that it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. This compound may exhibit properties such as solubility in polar solvents due to the presence of the amino group, and it could potentially act as a ligand in coordination chemistry or as an intermediate in organic synthesis. Its biological significance may also be explored, particularly in the context of medicinal chemistry, where derivatives of pyrrole compounds are often investigated for their pharmacological properties. Overall, 1H-Pyrrole-2,5-dione, 1-(2-aminoethyl)- is a compound of interest in both synthetic and medicinal chemistry.
Formula:C6H8N2O2
InChI:InChI=1S/C6H8N2O2/c7-3-4-8-5(9)1-2-6(8)10/h1-2H,3-4,7H2
InChI key:ODVRLSOMTXGTMX-UHFFFAOYSA-N
SMILES:C1=CC(=O)N(C1=O)CCN
Found 1 products.