CAS 125926-17-2
:Sarpogrelate
Description:
Sarpogrelate is a chemical compound primarily known for its role as an antiplatelet agent. It functions by selectively inhibiting the serotonin receptor 5-HT2A, which plays a crucial role in platelet aggregation. This mechanism helps to prevent thrombus formation, making it beneficial in the treatment of cardiovascular diseases. Sarpogrelate is often used in clinical settings to reduce the risk of thrombotic events in patients with conditions such as peripheral arterial disease. The compound is typically administered in oral form and is characterized by its relatively low toxicity profile. Its pharmacokinetics involve absorption, metabolism, and excretion processes that are essential for its therapeutic efficacy. Additionally, Sarpogrelate has been studied for its potential effects on vascular smooth muscle cells and its ability to improve blood flow. As with any medication, it is important to consider potential side effects and contraindications, which should be discussed with a healthcare provider. Overall, Sarpogrelate represents a significant advancement in the management of thrombotic disorders.
Formula:C24H31NO6
InChI:InChI=1S/C24H31NO6/c1-25(2)16-21(31-24(28)14-13-23(26)27)17-30-22-10-5-4-8-19(22)12-11-18-7-6-9-20(15-18)29-3/h4-10,15,21H,11-14,16-17H2,1-3H3,(H,26,27)
InChI key:InChIKey=FFYNAVGJSYHHFO-UHFFFAOYSA-N
SMILES:O(CC(OC(CCC(O)=O)=O)CN(C)C)C1=C(CCC2=CC(OC)=CC=C2)C=CC=C1
Synonyms:- (+-)-2-(Dimethylamino)-1-((o-(m-methoxyphenethyl)phenoxy)methyl)ethyl hydrogen succinate
- 4-(1-(2-(3-Methoxyphenethyl)phenoxy)-3-(dimethylamino)propan-2-yloxy)-4-oxobutanoic acid
- 4-{[1-(Dimethylamino)-3-{2-[2-(3-Methoxyphenyl)Ethyl]Phenoxy}Propan-2-Yl]Oxy}-4-Oxobutanoic Acid
- Butanedioic acid, 1-[2-(dimethylamino)-1-[[2-[2-(3-methoxyphenyl)ethyl]phenoxy]methyl]ethyl] ester
- Butanedioic acid, mono[2-(dimethylamino)-1-[[2-[2-(3-methoxyphenyl)ethyl]phenoxy]methyl]ethyl] ester
- Unii-19P708E787
- Sarpogrelate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Sarpogrelate
CAS:Sarpogrelate (MCI-9042), an oral 5-HT2 antagonist, boosts platelet aggregation and aids in studying Buerger's disease.Formula:C24H31NO6Color and Shape:SolidMolecular weight:429.51Sarpogrelate
CAS:Sarpogrelate is a drug that belongs to the class of small molecule ligands. It binds to and activates the receptor for GnRH, thereby inhibiting the release of LH and FSH from the pituitary gland. Sarpogrelate has been shown to be an inhibitor of ion channels, such as calcium channels. Sarpogrelate is also used as a research tool in biology, pharmacology, and cell biology.
Formula:C24H31NO6Purity:Min. 95%Molecular weight:429.5 g/molRef: 3D-AFA92617
Discontinued product


