CAS 1259326-52-7
:7-Chloro-1,2,3,4-tetrahydro-6-isoquinolinamine
Description:
7-Chloro-1,2,3,4-tetrahydro-6-isoquinolinamine is a chemical compound characterized by its isoquinoline structure, which consists of a bicyclic system containing a nitrogen atom. The presence of a chlorine atom at the 7-position contributes to its unique reactivity and potential biological activity. This compound features a tetrahydro configuration, indicating that it has four hydrogen atoms added to the isoquinoline framework, resulting in a saturated structure. The amine functional group suggests that it can participate in hydrogen bonding and may exhibit basic properties. This compound may be of interest in medicinal chemistry due to its potential pharmacological applications, particularly in the development of therapeutic agents. Its specific interactions with biological targets, solubility, and stability would depend on its molecular structure and the presence of substituents. As with many organic compounds, its synthesis, characterization, and potential applications would be explored in the context of drug discovery and development.
Formula:C9H11ClN2
InChI:InChI=1S/C9H11ClN2/c10-8-3-7-5-12-2-1-6(7)4-9(8)11/h3-4,12H,1-2,5,11H2
InChI key:InChIKey=BDDFKXZDDQGDSD-UHFFFAOYSA-N
SMILES:NC=1C=C2C(=CC1Cl)CNCC2
Synonyms:- 7-Chloro-1,2,3,4-tetrahydro-6-isoquinolinamine
- 6-Isoquinolinamine, 7-chloro-1,2,3,4-tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
