
CAS 1259393-29-7
:Ethyl 4-[(2,4-dimethylphenyl)amino]butanoate
Description:
Ethyl 4-[(2,4-dimethylphenyl)amino]butanoate, identified by its CAS number 1259393-29-7, is an organic compound characterized by its ester functional group, which is typical of ethyl esters. This compound features a butanoate backbone, indicating a four-carbon chain with a carboxylic acid derivative. The presence of the 2,4-dimethylphenyl group suggests that it has a substituted aromatic ring, which can influence its chemical reactivity and physical properties, such as solubility and boiling point. The amino group attached to the aromatic ring indicates potential for hydrogen bonding and may affect the compound's biological activity. Ethyl esters generally exhibit moderate volatility and can be soluble in organic solvents, making them useful in various applications, including pharmaceuticals and agrochemicals. The specific structural features of this compound may also contribute to its potential as a ligand or intermediate in synthetic chemistry. Overall, the characteristics of Ethyl 4-[(2,4-dimethylphenyl)amino]butanoate suggest a compound with diverse chemical behavior and potential applications in research and industry.
Formula:C14H21NO2
InChI:InChI=1S/C14H21NO2/c1-4-17-14(16)6-5-9-15-13-8-7-11(2)10-12(13)3/h7-8,10,15H,4-6,9H2,1-3H3
InChI key:InChIKey=UOMPYKJDLLUIMV-UHFFFAOYSA-N
SMILES:N(CCCC(OCC)=O)C1=C(C)C=C(C)C=C1
Synonyms:- Ethyl 4-[(2,4-dimethylphenyl)amino]butanoate
- Butanoic acid, 4-[(2,4-dimethylphenyl)amino]-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.