CAS 125941-87-9
:(5R)-8-chloro-3-methyl-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-ol hydrochloride (1:1)
Description:
(5R)-8-chloro-3-methyl-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-ol hydrochloride is a chemical compound characterized by its complex bicyclic structure, which includes a benzazepine core. This compound features a chlorine atom and a hydroxyl group, contributing to its potential biological activity. The presence of a phenyl group and a methyl group enhances its lipophilicity, which may influence its pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water than its free base form, facilitating its use in pharmaceutical formulations. The stereochemistry indicated by the (5R) designation suggests specific spatial arrangements of atoms, which can significantly affect the compound's interaction with biological targets. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. However, detailed studies on its efficacy, safety, and mechanism of action would be necessary to fully understand its potential applications.
Formula:C17H19Cl2NO
InChI:InChI=1/C17H18ClNO.ClH/c1-19-8-7-13-9-16(18)17(20)10-14(13)15(11-19)12-5-3-2-4-6-12;/h2-6,9-10,15,20H,7-8,11H2,1H3;1H/t15-;/m1./s1
SMILES:CN1CCc2cc(c(cc2[C@H](C1)c1ccccc1)O)Cl.Cl
Synonyms:- 1H-3-Benzazepin-7-ol, 8-chloro-2,3,4,5-tetrahydro-3-methyl-5-phenyl-, (5R)-, hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
SCH 23390 (hydrochloride)
CAS:Formula:C17H19Cl2NOPurity:98%Color and Shape:SolidMolecular weight:324.2449SCH-23390 hydrochloride
CAS:SCH-23390 hydrochloride (R-(+)-SCH23390 hydrochloride) is an effective dopamine receptor antagonist, and for the D1(Ki=0.2 nM) and D5(Ki=0.3 nM).Formula:C17H19Cl2NOPurity:98% - 99.83%Color and Shape:SolidMolecular weight:324.24Ref: TM-T4369
1mg37.00€2mg52.00€5mg73.00€1mL*10mM (DMSO)73.00€10mg92.00€25mg185.00€50mg350.00€100mg522.00€SCH 23390 hydrochloride
CAS:Antagonist of D1-like dopamine receptor subtypes, D1 and D5 (Ki values 0.2 and 0.3 nM respectively). Agonist of serotonin receptors 5-HT1C and 5-HT2C (Ki values 6.3 nM and 9.3 nM respectively). Used to study the topography of D1 receptors in humans and animals. Reduces seizures in response to chemoconvulsants and has also been studied in other neurological disorders.Formula:C17H18ClNO·HClPurity:Min. 95%Color and Shape:White/Off-White SolidMolecular weight:324.24(R)-(+)-Sch 23390 Hydrochloride
CAS:Controlled ProductFormula:C17H18ClNO·HClColor and Shape:NeatMolecular weight:324.245




