CAS 1259489-94-5

1,1-Dimethylethyl 1,6-diazaspiro[4.5]decane-6-carboxylate

Description:

1,1-Dimethylethyl 1,6-diazaspiro[4.5]decane-6-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which includes a diazabicyclic framework. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the dimethyl group enhances steric hindrance, which can influence its interactions with other molecules. The spiro structure indicates that the compound has two rings that share a single atom, which can impart distinctive conformational properties and stability. This compound may exhibit interesting biological activities due to its complex structure, making it a candidate for further research in medicinal chemistry. Its CAS number, 1259489-94-5, allows for easy identification in chemical databases. Overall, the characteristics of this compound suggest potential applications in various fields, including pharmaceuticals and materials science, although specific properties such as melting point, boiling point, and solubility would require empirical data for comprehensive understanding.

Formula: C₁₃H₂₄N₂O₂

InChI: InChI=1S/C13H24N2O2/c1-12(2,3)17-11(16)15-10-5-4-7-13(15)8-6-9-14-13/h14H,4-10H2,1-3H3

InChI key: InChIKey=SSPFZTCMBZHRDB-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C2(CCCN2)CCCC1

Synonyms:

• 1,6-Diazaspiro[4.5]decane-6-carboxylic acid, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 1,6-diazaspiro[4.5]decane-6-carboxylate