CAS 125961-36-6
:HSR 175
Description:
HSR 175, with the CAS number 125961-36-6, is a chemical compound that belongs to a class of substances known for their specific applications in various fields, including pharmaceuticals and materials science. While detailed information about HSR 175 may not be widely available, compounds with similar structures often exhibit properties such as moderate to high solubility in organic solvents, potential biological activity, and the ability to interact with biological targets. The characteristics of such compounds can include specific functional groups that influence their reactivity, stability, and interaction with other molecules. Additionally, they may possess unique physical properties such as melting and boiling points, which are critical for their application in synthesis and formulation processes. Understanding the precise characteristics of HSR 175 would typically require experimental data or detailed literature reviews, focusing on its molecular structure, reactivity, and potential uses in various industrial or research applications.
Formula:C19H26ClFN2O5S
InChI:InChI=1/C19H25FN2O5S.ClH/c1-13(10-14-4-6-17(26-3)19(11-14)28(21,23)24)22-8-9-27-18-12-15(20)5-7-16(18)25-2;/h4-7,11-13,22H,8-10H2,1-3H3,(H2,21,23,24);1H
SMILES:CC(Cc1ccc(c(c1)S(=O)(=O)N)OC)NCCOc1cc(ccc1OC)F.Cl
Synonyms:- 5-(2-((2-(5-Fluoro-2-methoxyphenoxy)ethyl)amino)propyl)-2-methoxybenzenesulfonamide hydrochloride
- Benzenesulfonamide, 5-(2-((2-(5-fluoro-2-methoxyphenoxy)ethyl)amino)propyl)-2-methoxy-, monohydrochloride, (R)-
- 5-(2-{[2-(5-Fluoro-2-Methoxyphenoxy)Ethyl]Amino}Propyl)-2-Methoxybenzenesulfonamide Hydrochloride (1:1)
- Hsr 175
- Hsr-175
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
HSR-175 HCl
CAS:HSR-175 HCl is an alpha 1-adrenoceptor antagonist.Formula:C19H26ClFN2O5SColor and Shape:SolidMolecular weight:448.93
