CymitQuimica logo

CAS 125969-76-8

:

3,3,3-Trifluoro-2-hydroxy-N-(phenylmethyl)propanamide

Description:
3,3,3-Trifluoro-2-hydroxy-N-(phenylmethyl)propanamide, with the CAS number 125969-76-8, is a chemical compound characterized by its unique trifluoromethyl group and a hydroxyl functional group, which contribute to its polar nature and potential for hydrogen bonding. The presence of the phenylmethyl group enhances its lipophilicity, making it more soluble in organic solvents. This compound is typically used in pharmaceutical research and development due to its potential biological activity, particularly in the context of drug design. Its trifluoromethyl group can influence the compound's metabolic stability and bioavailability. The molecular structure suggests that it may exhibit interesting interactions with biological targets, making it a subject of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the fluorine atoms, which can affect its overall chemical behavior. As with many fluorinated compounds, it is essential to handle it with care due to potential environmental and health impacts.
Formula:C10H10F3NO2
InChI:InChI=1S/C10H10F3NO2/c11-10(12,13)8(15)9(16)14-6-7-4-2-1-3-5-7/h1-5,8,15H,6H2,(H,14,16)
InChI key:InChIKey=NTLMSWVAOMVWLC-UHFFFAOYSA-N
SMILES:C(NC(C(C(F)(F)F)O)=O)C1=CC=CC=C1
Synonyms:
  • 3,3,3-Trifluoro-2-hydroxy-N-(phenylmethyl)propanamide
  • Propanamide, 3,3,3-trifluoro-2-hydroxy-N-(phenylmethyl)-
  • N-Benzyl-3,3,3-trifluoro-2-hydroxypropanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.