
CAS 125974-08-5
:3-Chloro-4-(chloromethyl)-5-hydroxy-2(5H)-furanone
Description:
3-Chloro-4-(chloromethyl)-5-hydroxy-2(5H)-furanone, with the CAS number 125974-08-5, is a synthetic organic compound characterized by its furanone structure, which includes a furan ring with various substituents. This compound features a chlorine atom at the 3-position, a chloromethyl group at the 4-position, and a hydroxyl group at the 5-position of the furanone ring. The presence of these functional groups suggests that it may exhibit reactivity typical of halogenated compounds, including potential electrophilic substitution and nucleophilic attack. Its hydroxyl group may also impart some degree of polarity, influencing its solubility in polar solvents. The compound is of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential biological activity. However, specific information regarding its toxicity, stability, and environmental impact would require further investigation and analysis. Overall, 3-Chloro-4-(chloromethyl)-5-hydroxy-2(5H)-furanone represents a complex structure with diverse chemical properties.
Formula:C5H4Cl2O3
InChI:InChI=1S/C5H4Cl2O3/c6-1-2-3(7)5(9)10-4(2)8/h4,8H,1H2
InChI key:InChIKey=WDEQLMYIIXBHTJ-UHFFFAOYSA-N
SMILES:C(Cl)C1=C(Cl)C(=O)OC1O
Synonyms:- 3-Chloro-4-(chloromethyl)-5-hydroxy-2,5-dihydrofuran-2-one
- 3-Chloro-4-(chloromethyl)-5-hydroxy-2(5H)-furanone
- 2(5H)-Furanone, 3-chloro-4-(chloromethyl)-5-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
