CAS 125983-31-5

2-chloro-N-[4-(diethylamino)phenyl]acetamide hydrochloride

Description:

2-Chloro-N-[4-(diethylamino)phenyl]acetamide hydrochloride is a chemical compound characterized by its structural features, which include a chloro substituent and a diethylamino group attached to a phenyl ring. This compound is typically classified as an amide due to the presence of the acetamide functional group. It is a hydrochloride salt, which enhances its solubility in water, making it suitable for various applications in pharmaceutical and biochemical research. The presence of the diethylamino group suggests potential basic properties, which may influence its interaction with biological systems. This compound may exhibit biological activity, potentially serving as a pharmacological agent or a research tool in studies related to drug development. Its specific characteristics, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other substances. As with many chemical compounds, safety data sheets should be consulted for handling and toxicity information.

Formula: C₁₂H₁₇ClN₂O

InChI: InChI=1/C12H17ClN2O/c1-3-15(4-2)11-7-5-10(6-8-11)14-12(16)9-13/h5-8H,3-4,9H2,1-2H3,(H,14,16)

SMILES: CCN(CC)c1ccc(cc1)NC(=O)CCl

Synonyms:

• 2-Chloro-N-[4-(diethylamino)phenyl]acetamide
• acetamide, 2-chloro-N-[4-(diethylamino)phenyl]-

2-Chloro-N-(4-diethylamino-phenyl)-acetamide

CAS: 125983-31-5

Versatile small molecule scaffold

Formula: C₁₂H₁₇ClN₂O

Purity: Min. 95%

Molecular weight: 240.73 g/mol

Ref: 3D-AFA98331