CAS 1259952-25-4

1H-Inden-1-ol, 2-amino-7-bromo-2,3-dihydro-, hydrochloride (1:1)

Description:

1H-Inden-1-ol, 2-amino-7-bromo-2,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which includes an indene moiety with a hydroxyl group and an amino group. The presence of the bromine atom at the 7-position contributes to its reactivity and potential applications in organic synthesis. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various chemical reactions and biological studies. This compound may exhibit biological activity due to the presence of the amino group, which can participate in hydrogen bonding and interact with biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Safety and handling precautions should be observed, as with any brominated compound, due to potential toxicity and environmental concerns. Overall, this compound represents a valuable entity for research in both synthetic and medicinal chemistry contexts.

Formula: C₉H₁₀BrNO·ClH

InChI: InChI=1S/C9H10BrNO.ClH/c10-6-3-1-2-5-4-7(11)9(12)8(5)6;/h1-3,7,9,12H,4,11H2;1H

InChI key: InChIKey=PLXKSEAWMLSNQR-UHFFFAOYSA-N

SMILES: OC1C=2C(CC1N)=CC=CC2Br.Cl

Synonyms:

• 1H-Inden-1-ol, 2-amino-7-bromo-2,3-dihydro-, hydrochloride (1:1)

1H-Inden-1-ol, 2-amino-7-bromo-2,3-dihydro-, hydrochloride (1:1)

CAS: 1259952-25-4

Formula: C₉H₁₁BrClNO

Molecular weight: 264.5467

Ref: IN-DA000QNB