CAS 1259978-35-2

7-Bromo-2-methoxythieno[3,2-d]pyrimidine

Description:

7-Bromo-2-methoxythieno[3,2-d]pyrimidine is a heterocyclic compound characterized by the presence of a thieno[3,2-d]pyrimidine core, which incorporates both sulfur and nitrogen atoms in its structure. The compound features a bromine atom at the 7-position and a methoxy group (-OCH3) at the 2-position, contributing to its unique chemical properties. This structure imparts specific reactivity and potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the bromine atom can enhance the compound's lipophilicity and influence its interaction with biological targets. Additionally, the methoxy group can affect solubility and stability. The compound's molecular framework suggests potential applications in pharmaceuticals, particularly in the development of agents targeting various diseases. As with many heterocycles, the electronic properties and steric factors associated with the substituents play a crucial role in determining the compound's reactivity and biological activity. Overall, 7-Bromo-2-methoxythieno[3,2-d]pyrimidine represents a valuable scaffold for further exploration in chemical and biological research.

Formula: C₇H₅BrN₂OS

InChI: InChI=1S/C7H5BrN2OS/c1-11-7-9-2-5-6(10-7)4(8)3-12-5/h2-3H,1H3

InChI key: InChIKey=QCMVNUJADNUTBT-UHFFFAOYSA-N

SMILES: BrC=1C=2C(=CN=C(OC)N2)SC1

Synonyms:

• 7-Bromo-2-methoxythieno[3,2-d]pyrimidine
• Thieno[3,2-d]pyrimidine, 7-bromo-2-methoxy-