CAS 126-00-1
:4,4′-Bis(4-hydroxyphenyl)valeric acid
Description:
4,4′-Bis(4-hydroxyphenyl)valeric acid, also known by its CAS number 126-00-1, is an organic compound characterized by its structure, which features two 4-hydroxyphenyl groups attached to a valeric acid moiety. This compound is a type of bisphenol and is notable for its potential applications in the synthesis of polymers and as a building block in organic chemistry. It exhibits properties typical of phenolic compounds, such as the ability to form hydrogen bonds due to the presence of hydroxyl groups, which can influence its solubility and reactivity. The compound is generally solid at room temperature and may have a moderate melting point. Its chemical behavior is influenced by the presence of both the hydroxyl groups and the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and polymerization. Additionally, it may exhibit antioxidant properties, making it of interest in materials science and pharmaceuticals. Safety data should be consulted for handling and exposure guidelines.
Formula:C17H18O4
InChI:InChI=1S/C17H18O4/c1-17(11-10-16(20)21,12-2-6-14(18)7-3-12)13-4-8-15(19)9-5-13/h2-9,18-19H,10-11H2,1H3,(H,20,21)
InChI key:InChIKey=VKOUCJUTMGHNOR-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)(C)(C1=CC=C(O)C=C1)C2=CC=C(O)C=C2
Synonyms:- 4,4'-Bis(4-Hydroxyphenyl)Valeric Acid
- 4,4-Bis(3,5-Dibromo-4-Hydroxyphenyl)Pentanoic Acid
- 4,4-Bis(4-Hydroxyphenyl)Pentanoic Acid
- 4,4-Bis(4-hydroxyphenyl)pentanic acid
- 4,4-Bis(p-hydroxyphenyl)pentanoic acid
- 4,4-Bis(p-hydroxyphenyl)valeric acid
- 4-Hydroxy-γ-(4-hydroxyphenyl)-γ-methylbenzenebutanoic acid
- Benzenebutanoic acid, 4-hydroxy-γ-(4-hydroxyphenyl)-γ-methyl-
- Bisphenol acid
- Ctfa
- D 1274
- NSC 3371
- NSC 34824
- NSC 55069
- Valeric acid, 4,4-bis(p-hydroxyphenyl)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4,4-Bis(4-hydroxyphenyl)valeric acid
CAS:Formula:C17H18O4Purity:98%Color and Shape:SolidMolecular weight:286.32244,4-Bis(4-hydroxyphenyl)valeric Acid
CAS:4,4-Bis(4-hydroxyphenyl)valeric AcidPurity:98%Molecular weight:286.33g/molDiphenolic Acid
CAS:Controlled ProductApplications Diphenolic acid (CAS# 126-00-1) is a useful research chemical compound.
Formula:C17H18O4Color and Shape:NeatMolecular weight:286.32Diphenolic acid
CAS:Diphenolic acid is a reactive compound that is used as a solid catalyst. It has a hydroxyl group and a fatty acid, which makes it soluble in organic solvents. The methyl ethyl ester of diphenolic acid can be obtained from the reaction of diphenolic acid with methanol, ethanol or ethylene glycol. Diphenolic acid can also be obtained by reacting dibenzalacetone with an alcohol. Diphenolic acid has been used to synthesize monoclonal antibodies and linear calibration curves for electrochemical impedance spectroscopy. The hydroxyl group on diphenolic acid allows it to undergo reactions that are not possible for other compounds such as phenols, leading to its use in surface methodology and flow systems.Formula:C17H18O4Color and Shape:White PowderMolecular weight:286.32 g/molDiphenolic Acid
CAS:Formula:C17H18O4Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:286.33






