
CAS 126-20-5
:1,3-Dioxolane-4,4-diacetic acid, 5-oxo-, sodium salt (1:2)
Description:
1,3-Dioxolane-4,4-diacetic acid, 5-oxo-, sodium salt (1:2), with CAS number 126-20-5, is a chemical compound characterized by its dioxolane ring structure, which contributes to its stability and reactivity. This compound features two carboxylic acid groups that are deprotonated to form a sodium salt, enhancing its solubility in aqueous environments. It is typically used in various chemical syntheses and may serve as a building block in organic chemistry due to its functional groups. The presence of the 5-oxo group indicates that it has a carbonyl functionality, which can participate in further chemical reactions, such as nucleophilic additions. The sodium salt form suggests that it can be utilized in biological or pharmaceutical applications, where solubility and bioavailability are crucial. Overall, this compound exhibits properties typical of dioxolane derivatives, including potential applications in drug development, agrochemicals, and as intermediates in organic synthesis.
Formula:C7H8O7·2Na
InChI:InChI=1S/C7H8O7.2Na/c8-4(9)1-7(2-5(10)11)6(12)13-3-14-7;;/h1-3H2,(H,8,9)(H,10,11);;
InChI key:InChIKey=UJTXFFJPMLFSJT-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1(CC(O)=O)C(=O)OCO1.[Na]
Synonyms:- 1,2,3-Propanetricarboxylic acid, 2-(hydroxymethoxy)-, γ-lactone, disodium salt
- 1,3-Dioxolane-4,4-diacetic acid, 5-oxo-, sodium salt (1:2)
- Goutin
- 1,3-Dioxolane-4,4-diacetic acid, 5-oxo-, disodium salt
- Citarin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3-Dioxolane-4,4-diacetic acid, 5-oxo-, sodium salt (1:2)
CAS:Formula:C7H6Na2O7Molecular weight:248.0979
