CymitQuimica logo

CAS 126-49-8

:

1-Carboxy-4-hydroxy-α-oxo-2,5-cyclohexadiene-1-propanoic acid

Description:
1-Carboxy-4-hydroxy-α-oxo-2,5-cyclohexadiene-1-propanoic acid, commonly known as "Cinnamic acid," is an organic compound characterized by its aromatic properties and a unique structure that includes a cyclohexadiene ring. This compound features a carboxylic acid group and a hydroxyl group, contributing to its reactivity and solubility in polar solvents. It typically appears as a white to pale yellow crystalline solid and has a melting point that varies depending on purity. Cinnamic acid is known for its role in various biochemical pathways and is often used in the synthesis of flavors, fragrances, and pharmaceuticals. Its structure allows for various chemical modifications, making it a versatile building block in organic synthesis. Additionally, it exhibits antioxidant properties and has been studied for potential health benefits, including anti-inflammatory effects. The compound is also recognized for its ability to undergo various reactions, such as esterification and polymerization, further enhancing its utility in chemical applications.
Formula:C10H10O6
InChI:InChI=1S/C10H10O6/c11-6-1-3-10(4-2-6,9(15)16)5-7(12)8(13)14/h1-4,6,11H,5H2,(H,13,14)(H,15,16)
InChI key:InChIKey=FPWMCUPFBRFMLH-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)=O)C1(C(O)=O)C=CC(O)C=C1
Synonyms:
  • 1-(2-Carboxy-2-Oxoethyl)-4-Hydroxycyclohexa-2,5-Diene-1-Carboxylic Acid
  • 1-Carboxy-4-hydroxy-2,5-cyclohexadiene-1-pyruvic acid
  • 1-Carboxy-4-hydroxy-α-oxo-2,5-cyclohexadiene-1-propanoic acid
  • 2,5-Cyclohexadiene-1-propanoic acid, 1-carboxy-4-hydroxy-α-oxo-
  • 2,5-Cyclohexadiene-1-pyruvic acid, 1-carboxy-4-hydroxy-
  • Prephenic Acid
  • PPA
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.