CAS 1260-04-4: (2beta,3beta,4alpha)-2,3-Dihydroxy-27-norolean-13-ene-23,28-dioic acid
Description:(2beta,3beta,4alpha)-2,3-Dihydroxy-27-norolean-13-ene-23,28-dioic acid, with CAS number 1260-04-4, is a triterpenoid compound derived from oleanolic acid, characterized by its unique structural features, including multiple hydroxyl groups and a modified oleanane skeleton. This compound typically exhibits a complex molecular structure that contributes to its biological activity, including potential anti-inflammatory and antioxidant properties. The presence of hydroxyl groups enhances its solubility in polar solvents and may influence its interaction with biological membranes and proteins. Additionally, the presence of the 27-nor group indicates a loss of a carbon atom compared to the parent oleanolic acid structure, which may affect its pharmacological profile. Triterpenoids like this compound are often studied for their potential therapeutic applications, including their roles in traditional medicine and modern pharmacology. Overall, the characteristics of this compound make it a subject of interest in both natural product chemistry and medicinal research.
Formula:C29H44O6
InChI:InChI=1S/C29H44O6/c1-25(2)12-13-29(24(34)35)11-8-17-16(18(29)14-25)6-7-20-26(17,3)10-9-21-27(20,4)15-19(30)22(31)28(21,5)23(32)33/h18-22,30-31H,6-15H2,1-5H3,(H,32,33)(H,34,35)/t18-,19-,20-,21+,22-,26-,27+,28-,29+/m0/s1
InChI key:InChIKey=VZRKWGPIZJDNHC-LUNVCWBOSA-N
SMILES:O=C(O)C12CCC3=C(CCC4C3(C)CCC5C(C(=O)O)(C)C(O)C(O)CC45C)C2CC(C)(C)CC1