CAS 1260-04-4
:(2beta,3beta,4alpha)-2,3-Dihydroxy-27-norolean-13-ene-23,28-dioic acid
Description:
(2beta,3beta,4alpha)-2,3-Dihydroxy-27-norolean-13-ene-23,28-dioic acid, with CAS number 1260-04-4, is a triterpenoid compound derived from oleanolic acid, characterized by its unique structural features, including multiple hydroxyl groups and a modified oleanane skeleton. This compound typically exhibits a complex molecular structure that contributes to its biological activity, including potential anti-inflammatory and antioxidant properties. The presence of hydroxyl groups enhances its solubility in polar solvents and may influence its interaction with biological membranes and proteins. Additionally, the presence of the 27-nor group indicates a loss of a carbon atom compared to the parent oleanolic acid structure, which may affect its pharmacological profile. Triterpenoids like this compound are often studied for their potential therapeutic applications, including their roles in traditional medicine and modern pharmacology. Overall, the characteristics of this compound make it a subject of interest in both natural product chemistry and medicinal research.
Formula:C29H44O6
InChI:InChI=1S/C29H44O6/c1-25(2)12-13-29(24(34)35)11-8-17-16(18(29)14-25)6-7-20-26(17,3)10-9-21-27(20,4)15-19(30)22(31)28(21,5)23(32)33/h18-22,30-31H,6-15H2,1-5H3,(H,32,33)(H,34,35)/t18-,19-,20-,21+,22-,26-,27+,28-,29+/m0/s1
InChI key:InChIKey=VZRKWGPIZJDNHC-LUNVCWBOSA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)([C@@](C(O)=O)(C)[C@@H](O)[C@@H](O)C3)[H])(CCC4=C2CC[C@]5(C(O)=O)[C@]4(CC(C)(C)CC5)[H])[H]
Synonyms:- 27-Norolean-13-ene-23,28-dioic acid, 2β,3β-dihydroxy-
- Senegenic acid
- Polygalic acid
- 27-Norolean-13-ene-23,28-dioic acid, 2,3-dihydroxy-, (2β,3β,4α)-
- (2β,3β,4α)-2,3-Dihydroxy-27-norolean-13-ene-23,28-dioic acid
- 2β,3β-Dihydroxy-27-nor-5α-olean-13-ene-23,28-dioic acid
- polygalic acid USP/EP/BP
- 2β,3β-Dihydroxy-27-norolean-13-ene-23,28-dioic acid
- (2beta,3beta,4alpha)-2,3-Dihydroxy-27-norolean-13-ene-23,28-dioic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Polygalic Acid
CAS:Polygalic acid, a triterpenoid saponin, shows expectorant, emetic and stimulant effects.Formula:C29H44O6Purity:95%~99%Color and Shape:PowderMolecular weight:488.665Polygalic acid
CAS:Polygalic acid (Senegenic acid), a triterpenoid saponin, is a major active ingredient in Polygala tenuifolia, shows expectorant, emetic and stimulant effects.Formula:C29H44O6Purity:99.24% - 99.52%Color and Shape:SolidMolecular weight:488.66Polygalic acid
CAS:Carboxylic acid with alcohol functionFormula:C29H44O6Purity:≥ 95.0 % (HPLC)Molecular weight:488.66Polygalic acid
CAS:<p>Polygalic acid is a saponin compound, which is derived from certain plant species, notably from the roots of Polygala. It is a naturally occurring surfactant, known for its ability to interact with cell membranes due to its amphiphilic nature. The mode of action of polygalic acid involves its integration into lipid bilayers, leading to increased membrane permeability. This characteristic impacts the movement of ions and molecules across cellular membranes, facilitating various biochemical processes.</p>Formula:C29H44O6Purity:Min. 95%Color and Shape:PowderMolecular weight:488.66 g/mol






