CymitQuimica logo

CAS 1260013-62-4

:

6-Bromo-5-fluoro-3,4-dihydro-1(2H)-naphthalenone

Description:
6-Bromo-5-fluoro-3,4-dihydro-1(2H)-naphthalenone is a chemical compound characterized by its unique structure, which includes a naphthalene core modified by bromine and fluorine substituents. This compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of bromine and fluorine atoms enhances its electrophilic properties, making it a valuable intermediate in the development of pharmaceuticals and agrochemicals. The dihydro form indicates that it has two hydrogen atoms added to the naphthalene structure, which can influence its physical properties, such as solubility and boiling point. Additionally, the compound's molecular geometry and electronic configuration may affect its interaction with biological targets, making it of interest in medicinal chemistry. As with many halogenated compounds, it is essential to consider its environmental impact and stability under various conditions. Overall, 6-Bromo-5-fluoro-3,4-dihydro-1(2H)-naphthalenone represents a versatile building block in synthetic organic chemistry.
Formula:C10H8BrFO
InChI:InChI=1S/C10H8BrFO/c11-8-5-4-6-7(10(8)12)2-1-3-9(6)13/h4-5H,1-3H2
InChI key:InChIKey=ZRBJQOYJAVKRFU-UHFFFAOYSA-N
SMILES:FC1=C2C(C(=O)CCC2)=CC=C1Br
Synonyms:
  • 6-Bromo-5-fluoro-3,4-dihydro-1(2H)-naphthalenone
  • 1(2H)-Naphthalenone, 6-bromo-5-fluoro-3,4-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.