CymitQuimica logo

CAS 1260018-38-9

:

5-Bromo-7-chloro-3,4-dihydro-1(2H)-naphthalenone

Description:
5-Bromo-7-chloro-3,4-dihydro-1(2H)-naphthalenone is an organic compound characterized by its complex bicyclic structure, which includes a naphthalene core with specific halogen substitutions. The presence of bromine and chlorine atoms introduces notable reactivity and influences the compound's physical and chemical properties, such as solubility and boiling point. This compound features a ketone functional group, contributing to its potential as a precursor in organic synthesis and medicinal chemistry. The dihydro form indicates that it has two hydrogen atoms added to the naphthalene structure, which can affect its stability and reactivity. Its unique structure may also impart specific biological activities, making it of interest in pharmaceutical research. The CAS number 1260018-38-9 serves as a unique identifier for this compound, facilitating its identification in chemical databases and literature. Overall, 5-Bromo-7-chloro-3,4-dihydro-1(2H)-naphthalenone is a compound of interest due to its structural features and potential applications in various fields of chemistry.
Formula:C10H8BrClO
InChI:InChI=1S/C10H8BrClO/c11-9-5-6(12)4-8-7(9)2-1-3-10(8)13/h4-5H,1-3H2
InChI key:InChIKey=SHOTVTQZHPADGR-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC(Cl)=C1)C(=O)CCC2
Synonyms:
  • 5-Bromo-7-chloro-3,4-dihydro-1(2H)-naphthalenone
  • 1(2H)-Naphthalenone, 5-bromo-7-chloro-3,4-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.