CAS 1260178-75-3

1,1-Dimethylethyl 3-(1,6-dihydro-2-methyl-6-oxo-4-pyrimidinyl)-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 3-(1,6-dihydro-2-methyl-6-oxo-4-pyrimidinyl)-1-piperidinecarboxylate, identified by its CAS number 1260178-75-3, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a pyrimidine moiety. This substance typically exhibits properties associated with both heterocyclic compounds and esters, suggesting potential applications in medicinal chemistry or as a pharmaceutical intermediate. The presence of the dimethyl group contributes to its steric hindrance, which may influence its reactivity and interaction with biological targets. Additionally, the pyrimidine derivative indicates potential biological activity, as pyrimidines are often found in various bioactive molecules. The compound's solubility, stability, and reactivity would depend on its specific functional groups and the overall molecular architecture. As with many organic compounds, its behavior in different solvents and under varying conditions can provide insights into its potential applications in drug development or other chemical processes.

Formula: C₁₅H₂₃N₃O₃

InChI: InChI=1S/C15H23N3O3/c1-10-16-12(8-13(19)17-10)11-6-5-7-18(9-11)14(20)21-15(2,3)4/h8,11H,5-7,9H2,1-4H3,(H,16,17,19)

InChI key: InChIKey=SRDQYSGSUBIARO-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(CCC1)C2=CC(=O)N=C(C)N2

Synonyms:

• 1,1-Dimethylethyl 3-(1,6-dihydro-2-methyl-6-oxo-4-pyrimidinyl)-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 3-(1,6-dihydro-2-methyl-6-oxo-4-pyrimidinyl)-, 1,1-dimethylethyl ester