CymitQuimica logo

CAS 1260215-33-5

:

4-(1-Propyn-1-yl)-2-(trimethylstannyl)pyridine

Description:
4-(1-Propyn-1-yl)-2-(trimethylstannyl)pyridine is an organometallic compound characterized by the presence of a pyridine ring substituted with both a propynyl group and a trimethylstannyl group. The pyridine moiety contributes to the compound's aromaticity and potential for coordination with metal centers, making it useful in various chemical reactions, particularly in organometallic chemistry and catalysis. The trimethylstannyl group introduces a tin atom, which can enhance the compound's reactivity and solubility in organic solvents. Additionally, the presence of the propynyl group provides a site for further functionalization, allowing for the synthesis of more complex molecules. This compound may exhibit unique properties such as specific reactivity patterns, stability under certain conditions, and potential applications in materials science or organic synthesis. Its structural features suggest it could be involved in cross-coupling reactions or serve as a precursor for the development of novel organometallic complexes. As with many organometallic compounds, handling should be done with care due to potential toxicity associated with tin derivatives.
Formula:C11H15NSn
InChI:InChI=1S/C8H6N.3CH3.Sn/c1-2-3-8-4-6-9-7-5-8;;;;/h4-6H,1H3;3*1H3;
InChI key:InChIKey=LGIYVLMZTDUSDH-UHFFFAOYSA-N
SMILES:[Sn](C)(C)(C)C1=CC(C#CC)=CC=N1
Synonyms:
  • 4-(1-Propyn-1-yl)-2-(trimethylstannyl)pyridine
  • 4-(Prop-1-ynyl)-2-(trimethylstannyl)pyridine
  • Pyridine, 4-(1-propyn-1-yl)-2-(trimethylstannyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.